MCC950 sodium
$250.00
CAS No.: 256373-96-3
Catalog No.: 152093
Purity: 98%
MF: C20H23N2NaO5S
MW: 426.47
Storage: 2-8 degree Celsius
SMILES: [Na+].CC(C)([O-])C1=COC(=C1)S(=O)(=O)NC(=O)NC1=C2CCCC2=CC2=C1CCC2
Catalog No.: 152093
Purity: 98%
MF: C20H23N2NaO5S
MW: 426.47
Storage: 2-8 degree Celsius
SMILES: [Na+].CC(C)([O-])C1=COC(=C1)S(=O)(=O)NC(=O)NC1=C2CCCC2=CC2=C1CCC2
sodium 2-(5-(N-((1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamoyl)sulfamoyl)furan-3-yl)propan-2-olate; CAS No.: 1061682-82-3 This chemical is known for its stability and reactivity. It is primarily used in the pharmaceutical industry for the synthesis of complex drug molecules.
Reviews
Write Your Own Review