Sulindac
$300.00
CAS No.: 38194-50-2
Catalog No.: 151553
Purity: 95%
MF: C20H17FO3S
MW: 356.418
Storage: 2-8 degree Celsius
SMILES: CC1=C(CC(O)=O)C2=C(C=CC(F)=C2)\C1=C/C1=CC=C(C=C1)S(C)=O
Catalog No.: 151553
Purity: 95%
MF: C20H17FO3S
MW: 356.418
Storage: 2-8 degree Celsius
SMILES: CC1=C(CC(O)=O)C2=C(C=CC(F)=C2)\C1=C/C1=CC=C(C=C1)S(C)=O
(Z)-2-(5-fluoro-2-methyl-1-(4-(methylsulfinyl)benzylidene)-1H-inden-3-yl)acetic acid; CAS No.: 38194-50-2 - A novel compound with potential applications in the development of new drugs, particularly in targeting specific pathways or mechanisms. ChemShuttle's focus on innovative bioactive compounds ensures access to cutting-edge research materials.
Reviews
Write Your Own Review