Daraxonrasib (RMC-6236)
$400.00
CAS No.: 2765081-21-6
Catalog No.: 199986
Purity: 98%
MF: C44H58N8O5S
MW: 811.06
Storage: 2-8 degree Celsius
SMILES: C[C@H](OC)C(N=CC(N1CCN(C)CC1)=C2)=[C@@]2[C@](N3CC)=C(CC(C)(C)COC([C@H]4NN(C([C@@H](NC([C@H]5C[C@@H]5C)=O)CC6=NC7=CS6)=O)CCC4)=O)C8=C3C=CC7=C8
Catalog No.: 199986
Purity: 98%
MF: C44H58N8O5S
MW: 811.06
Storage: 2-8 degree Celsius
SMILES: C[C@H](OC)C(N=CC(N1CCN(C)CC1)=C2)=[C@@]2[C@](N3CC)=C(CC(C)(C)COC([C@H]4NN(C([C@@H](NC([C@H]5C[C@@H]5C)=O)CC6=NC7=CS6)=O)CCC4)=O)C8=C3C=CC7=C8
Daraxonrasib (RMC-6236); CAS No.: 2765081-21-6: This compound is used in the synthesis of complex organic molecules. Its unique chemical structure and reactivity profile make it valuable in the production of fine chemicals and intermediates.
Reviews
Write Your Own Review