Nilvadipine; ARC029
$200.00
CAS No.: 75530-68-6
Catalog No.: 139062
Purity: 95%
MF: C19H19N3O6
MW: 385.376
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C)C#N
Catalog No.: 139062
Purity: 95%
MF: C19H19N3O6
MW: 385.376
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C)C#N
Nilvadipine; ARC029; 5-isopropyl 3-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate; CAS No.: 75530-68-6; ChemShuttle is a chemical synthesis company offering 5-isopropyl 3-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, a key intermediate for pharmaceutical research. Their CRO chemical synthesis services support the development of innovative therapeutics.
Reviews
Write Your Own Review