AB928
$400.00
CAS No.: 2239273-34-6
Catalog No.: ZB1610
Purity: 95%
MF: C23H22N8O
MW: 426.484
Storage: 2-8 degree Celsius
SMILES: NC1=NC(=CC(=N1)C=1C(=C(C#N)C=CC1)C)C=1N=NN(C1)CC1=NC(=CC=C1)C(C)(C)O
Catalog No.: ZB1610
Purity: 95%
MF: C23H22N8O
MW: 426.484
Storage: 2-8 degree Celsius
SMILES: NC1=NC(=CC(=N1)C=1C(=C(C#N)C=CC1)C)C=1N=NN(C1)CC1=NC(=CC=C1)C(C)(C)O
3-(2-amino-6-(1-((6-(2-hydroxypropan-2-yl)pyridin-2-yl)methyl)-1H-1,2,3-triazol-4-yl)pyrimidin-4-yl)-2-methylbenzonitrile; CAS No.: 2239273-34-6 A key component in pharmaceutical research, this chemical is known for its safety and efficacy. ChemShuttle s local R&D and US warehouse ensure consistent quality and timely delivery.
Reviews
Write Your Own Review