Peficitinib hydrobromide
$650.00
CAS No.: 1353219-05-2
Catalog No.: WLZ3779
Purity: 95%
MF: C18H23BrN4O2
MW: 407.312
Storage: 2-8 degree Celsius
SMILES: Br.OC12CC3C(C(CC(C1)C3)C2)NC2=C3C(=NC=C2C(=O)N)NC=C3
Catalog No.: WLZ3779
Purity: 95%
MF: C18H23BrN4O2
MW: 407.312
Storage: 2-8 degree Celsius
SMILES: Br.OC12CC3C(C(CC(C1)C3)C2)NC2=C3C(=NC=C2C(=O)N)NC=C3
CAS No.:1353219-05-2; Peficitinib hydrobromide. ChemShuttle’s chemical building blocks include Peficitinib hydrobromide (CAS No.:1353219-05-2), a JAK inhibitor for inflammatory diseases. CAS No.:1353219-05-2 is engineered as a chemical building block for oral formulation development. The firm’s chemical building blocks, such as CAS No.:1353219-05-2, undergo solubility and stability profiling. Clients integrate CAS No.:1353219-05-2 from ChemShuttle’s chemical building blocks catalog into their drug delivery platforms.
Reviews
Write Your Own Review