Enzalutamide Carboxylic Acid
$200.00
CAS No.: 1242137-15-0
Catalog No.: 181240
Purity: 95%
MF: C20H13F4N3O3S
MW: 451.401
Storage: 2-8 degree Celsius
SMILES: CC1(C)N(C(=S)N(C1=O)C1=CC(=C(C=C1)C#N)C(F)(F)F)C1=CC(F)=C(C=C1)C(O)=O
Catalog No.: 181240
Purity: 95%
MF: C20H13F4N3O3S
MW: 451.401
Storage: 2-8 degree Celsius
SMILES: CC1(C)N(C(=S)N(C1=O)C1=CC(=C(C=C1)C#N)C(F)(F)F)C1=CC(F)=C(C=C1)C(O)=O
4-(3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)-2-fluorobenzoic acid; CAS No.: 1242137-15-0; ChemShuttle, a leading chemical synthesis company, is dedicated to the production of chem blocks. These versatile chemical Screening Compounds are crucial for the synthesis of complex molecules in drug discovery and development. Our chem blocks are designed to provide researchers with reliable and efficient tools for their chemical synthesis needs.
Reviews
Write Your Own Review