Uridine
$250.00
CAS No.: 58-96-8
Catalog No.: 109538
Purity: 95%
MF: C9H12N2O6
MW: 244.203
Storage: 2-8 degree Celsius
SMILES: OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O
Catalog No.: 109538
Purity: 95%
MF: C9H12N2O6
MW: 244.203
Storage: 2-8 degree Celsius
SMILES: OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O
Uridine; 1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione; CAS No.: 58-96-8; As a worldwide chemical supplier, ChemShuttle provides uridine, a nucleoside essential for RNA synthesis and biochemical research. This compound is critical in antiviral drug development and molecular biology studies. The company s expertise in bioconjugation and nucleotide chemistry ensures high-purity products for advanced therapeutic and diagnostic applications.
Reviews
Write Your Own Review