3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one
$300.00
CAS No.: 160807-49-8
Catalog No.: 194273
Purity: 95%
MF: C16H11N3O2
MW: 277.283
Storage: 2-8 degree Celsius
SMILES: O\N=C\1/C(/NC2=CC=CC=C12)=C\1/C(NC2=CC=CC=C12)=O
Catalog No.: 194273
Purity: 95%
MF: C16H11N3O2
MW: 277.283
Storage: 2-8 degree Celsius
SMILES: O\N=C\1/C(/NC2=CC=CC=C12)=C\1/C(NC2=CC=CC=C12)=O
3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one; CAS No.: 160807-49-8; 3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one. PROPERTIES: 3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one is a crystalline solid. Its molecular formula is C22H15N3O2, and the molecular weight is approximately 357.37 g/mol. The compound has a melting point of approximately 170-172 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an indoline ring, a hydroxyimino group, and a ketone group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one serves as a valuable intermediate. The hydroxyimino group can undergo various reactions such as hydrolysis and acylation. The ketone group provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).
Reviews
Write Your Own Review