4-hydroxy-4-[5-(pyrimidin-2-yl)pyridin-2-yl]cyclohexan-1-one

4-hydroxy-4-[5-(pyrimidin-2-yl)pyridin-2-yl]cyclohexan-1-one

3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one

3-(hydroxyimino)-[2,3'-biindolinylidene]-2'-one

benzyl benzodithioate

$200.00
CAS No.: 27249-90-7
Catalog No.: 194769
Purity: 95%
MF: C14H12S2
MW: 244.384
Storage: 2-8 degree Celsius
SMILES: S=C(C1=CC=CC=C1)SCC2=CC=CC=C2
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194769
  • Size
    Price
    Stock
    Estimated Shipping Time
benzyl benzodithioate; CAS No.: 27249-90-7; benzyl benzodithioate. PROPERTIES: benzyl benzodithioate is a crystalline solid. Its molecular formula is C14H12OS2, and the molecular weight is approximately 260.38 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzodithioate group and a benzyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, benzyl benzodithioate serves as a valuable intermediate. The benzodithioate group can undergo various reactions such as hydrolysis and alkylation. The benzyl group provides steric effects. In the chemical industry, derivatives of this compound can be explored as potential intermediates for the synthesis of various organic compounds. For example, in the development of certain agrochemicals, the structure of benzyl benzodithioate can be utilized to design compounds with improved herbicidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:benzyl benzodithioate
Your Rating