AZD9496 deacrylic acid phenol
$350.00
CAS No.: 2173404-70-9
Catalog No.: 187420
Purity: 95%
MF: C22H23F3N2O
MW: 388.433
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C=C(C1[C@H]1N([C@@H](CC2=C1NC1=CC=CC=C21)C)CC(C)(C)F)F)O
Catalog No.: 187420
Purity: 95%
MF: C22H23F3N2O
MW: 388.433
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C=C(C1[C@H]1N([C@@H](CC2=C1NC1=CC=CC=C21)C)CC(C)(C)F)F)O
3,5-difluoro-4-((1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol,CAS No.: 2241669-80-5 This substance is known for its specific chemical characteristics and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review