Corynoxine
$400.00
CAS No.: 6877-32-3
Catalog No.: ZB1866
Purity: 95%
MF: C22H28N2O4
MW: 384.476
Storage: 2-8 degree Celsius
SMILES: C(C)[C@@H]1CN2CC[C@]3([C@@H]2C[C@@H]1/C(/C(=O)OC)=C\OC)C(NC1=CC=CC=C13)=O
Catalog No.: ZB1866
Purity: 95%
MF: C22H28N2O4
MW: 384.476
Storage: 2-8 degree Celsius
SMILES: C(C)[C@@H]1CN2CC[C@]3([C@@H]2C[C@@H]1/C(/C(=O)OC)=C\OC)C(NC1=CC=CC=C13)=O
Corynoxine; (E)-methyl 2-((1'S,6'S,7'S,8a'S)-6'-ethyl-2-oxo-3',5',6',7',8',8a'-hexahydro-2'H-spiro[indoline-3,1'-indolizin]-7'-yl)-3-methoxyacrylate; CAS No.: 6877-32-3; As a custom chemical synthesis company, ChemShuttle provides a wide range of screening compounds, including the complex molecule (E)-methyl 2-((1'S,6'S,7'S,8a'S)-6'-ethyl-2-oxo-3',5',6',7',8',8a'-hexahydro-2'H-spiro[indoline-3,1'-indolizin]-7'-yl)-3-methoxyacrylate. This compound is of particular interest in the field of organic chemistry and drug discovery due to its unique structure and potential applications. ChemShuttle's expertise in Small molecules synthesis allows for the efficient production of this compound, ensuring its quality and reliability for research purposes. The company's status as a worldwide chemical supplier ensures that scientists and researchers have access to this and other valuable compounds, supporting innovation and progress in various scientific fields. Through their comprehensive Library of Compounds and commitment to customer satisfaction, ChemShuttle continues to be a trusted partner in the chemical industry.
Reviews
Write Your Own Review