PD153035 HCl
$280.00
CAS No.: 183322-45-4
Catalog No.: 109799
Purity: 95%
MF: C16H15BrClN3O2
MW: 396.672
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC2=NC=NC(NC3=CC=CC(Br)=C3)=C2C=C1OC
Catalog No.: 109799
Purity: 95%
MF: C16H15BrClN3O2
MW: 396.672
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC2=NC=NC(NC3=CC=CC(Br)=C3)=C2C=C1OC
PD153035 HCl; N-(3-bromophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride; CAS No.: 183322-45-4; ChemShuttle specializes in providing key intermediates such as N-(3-bromophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride, which are essential for pharmaceutical research and development. As a chemical synthesis company, we offer high-purity compounds designed to support drug discovery and medicinal chemistry projects. Our expertise in custom synthesis ensures that clients receive tailored solutions for complex molecular structures, enabling advancements in therapeutic innovation.
Reviews
Write Your Own Review