5-bromo-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-3-(ethyl(tetrahydro-2H-pyran-4-yl)amino)-2-methylbenzamide

5-bromo-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-3-(ethyl(tetrahydro-2H-pyran-4-yl)amino)-2-methylbenzamide

(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)tetrahydro-2H-pyran-3,4,5-triol

(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)tetrahydro-2H-pyran-3,4,5-triol

3-oxo-7-hydroxychol-4-enoic acid

$300.00
CAS No.: 14772-95-3
Catalog No.: 190843
Purity: 95%
MF: C24H36O4
MW: 388.548
Storage: 2-8 degree Celsius
SMILES: O=C1C=C2CC([C@H]3[C@@H]4CC[C@H]([C@@H](CCC(=O)O)C)[C@]4(CC[C@@H]3[C@]2(CC1)C)C)O
Availability:
In stock
SKU
190843
  • Size
    Price
    Stock
    Estimated Shipping Time
3-oxo-7-hydroxychol-4-enoic acid; CAS No.: 14772-95-3; 3-oxo-7-hydroxychol-4-enoic acid is a specialized chem block offered by ChemShuttle, a reputable chemical synthesis company focused on providing essential intermediates for advanced chemical research. This oxosteroid derivative serves as a versatile starting material in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle's inventory of building blocks chemistry includes numerous steroidal compounds like 3-oxo-7-hydroxychol-4-enoic acid (CAS No.: 14772-95-3), which are critical for constructing complex molecular frameworks through functionalization reactions. As a custom chemical synthesis company, ChemShuttle can produce this compound in various quantities, meeting specific purity requirements for diverse applications. Their online platform simplifies the procurement process, allowing researchers to access high-quality 3-oxo-7-hydroxychol-4-enoic acid and other key intermediates essential for advancing chemical research and development.

Reviews

Write Your Own Review
You're reviewing:3-oxo-7-hydroxychol-4-enoic acid
Your Rating