![6-bromo-5-methoxy-1H-benzo[d][1,2,3]triazole](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/177306_4.jpg)
(R)-3-bromo-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide
$225.00
CAS No.: 206193-17-1
Catalog No.: 177242
Purity: 95%
MF: C12H10BrF3N2O2
MW: 351.122
Storage: 2-8 degree Celsius
SMILES: C[C@](O)(CBr)C(=O)NC1=CC(=C(C=C1)C#N)C(F)(F)F
Catalog No.: 177242
Purity: 95%
MF: C12H10BrF3N2O2
MW: 351.122
Storage: 2-8 degree Celsius
SMILES: C[C@](O)(CBr)C(=O)NC1=CC(=C(C=C1)C#N)C(F)(F)F
(R)-3-bromo-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide; CAS No.: 206193-17-1; ChemShuttle, a leading chemical synthesis company, is dedicated to the production of chem blocks. These versatile chemical building blocks are crucial for the synthesis of complex molecules in drug discovery and development. Our chem blocks are designed to provide researchers with reliable and efficient tools for their chemical synthesis needs.
Reviews
Write Your Own Review