(R)-3-amino-3-(4-bromophenyl)propanoic acid
$833.00
CAS No.: 479074-63-0
Catalog No.: 105651
Purity: 95%
MF: C9H10BrNO2
MW: 244.088
Storage: 2-8 degree Celsius
SMILES: N[C@H](CC(O)=O)C1=CC=C(Br)C=C1
Catalog No.: 105651
Purity: 95%
MF: C9H10BrNO2
MW: 244.088
Storage: 2-8 degree Celsius
SMILES: N[C@H](CC(O)=O)C1=CC=C(Br)C=C1
(R)-3-amino-3-(4-bromophenyl)propanoic acid; CAS No.: 479074-63-0; ChemShuttle is a chemical synthesis company specializing in the production of building blocks for drug discovery, such as (R)-3-amino-3-(4-bromophenyl)propanoic acid. This chiral compound serves as a versatile intermediate in pharmaceutical research, enabling the development of targeted therapeutics. The company offers custom synthesis services to support medicinal chemistry projects, ensuring high purity and precise stereochemistry for complex molecular architectures.
Reviews
Write Your Own Review