(R)-2-benzylsuccinic acid
$275.00
CAS No.: 21307-97-1
Catalog No.: 188920
Purity: 95%
MF: C11H12O4
MW: 208.213
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)[C@@H](C(=O)O)CC(=O)O
Catalog No.: 188920
Purity: 95%
MF: C11H12O4
MW: 208.213
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)[C@@H](C(=O)O)CC(=O)O
(R)-2-benzylsuccinic acid; CAS No.: 21307-97-1; (R)-2-benzylsuccinic acid belongs to Chem Shuttle's collection of chiral building blocks that are essential for drug discovery. As a leading chemicals distributor, Chem Shuttle provides access to enantiomerically pure compounds like this benzylsuccinic acid derivative. The chiral center at the alpha position makes this compound valuable as a pharmaceutical intermediate, particularly in the synthesis of drugs requiring specific stereochemistry. Chem Shuttle's custom synthesis services allow for the production of such chiral acids to exact specifications, supporting the development of stereospecific medications. The company's focus on chemical blocks ensures that researchers can obtain high-quality, pure forms of (R)-2-benzylsuccinic acid, facilitating advancements in asymmetric synthesis and chiral drug development.
Reviews
Write Your Own Review