(R)-2-amino-3-(4-nitrophenyl)propanoic acid
$200.00
CAS No.: 56613-61-7
Catalog No.: 134499
Purity: 95%
MF: C9H10N2O4
MW: 210.189
Storage: 2-8 degree Celsius
SMILES: N[C@H](CC1=CC=C(C=C1)[N+]([O-])=O)C(O)=O
Catalog No.: 134499
Purity: 95%
MF: C9H10N2O4
MW: 210.189
Storage: 2-8 degree Celsius
SMILES: N[C@H](CC1=CC=C(C=C1)[N+]([O-])=O)C(O)=O
(R)-2-amino-3-(4-nitrophenyl)propanoic acid; CAS No.: 56613-61-7. ChemShuttle excels in supplying cycle compounds like (R)-2-amino-3-(4-nitrophenyl)propanoic acid, catering to the needs of chemical synthesis companies.
Reviews
Write Your Own Review