(R)-2-(4-hydroxyphenyl)-2-pivalamidoacetic acid
$300.00
CAS No.: 205826-86-4
Catalog No.: 101637
Purity: 95%
MF: C13H17NO4
MW: 251.282
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)C(=O)N[C@@H](C(O)=O)C1=CC=C(O)C=C1
Catalog No.: 101637
Purity: 95%
MF: C13H17NO4
MW: 251.282
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)C(=O)N[C@@H](C(O)=O)C1=CC=C(O)C=C1
(R)-2-(4-hydroxyphenyl)-2-pivalamidoacetic acid; CAS No.: 205826-86-4; As a worldwide chemical supplier, ChemShuttle provides access to various organic chemicals, including (R)-2-(4-hydroxyphenyl)-2-pivalamidoacetic acid. The company's focus on building blocks chemistry supports drug discovery by offering essential intermediates. Researchers can benefit from ChemShuttle's comprehensive collection of chemical building blocks, which includes diverse heterocycles and cycle compounds.
Reviews
Write Your Own Review