(R)-(-)-1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid monomethyl ester
$250.00
CAS No.: 76093-33-9
Catalog No.: 100882
Purity: 95%
MF: C16H16N2O6
MW: 332.312
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C)NC(C)=C([C@H]1C1=CC=CC(=C1)[N+]([O-])=O)C(O)=O
Catalog No.: 100882
Purity: 95%
MF: C16H16N2O6
MW: 332.312
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C)NC(C)=C([C@H]1C1=CC=CC(=C1)[N+]([O-])=O)C(O)=O
(R)-(-)-1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid monomethyl ester; CAS No.: 76093-33-9; ChemShuttle offers various organic chemicals like (R)-(-)-1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid monomethyl ester, used in medicinal chemistry and material science. As a Library of Compounds, we provide a diverse range of high-quality intermediates. We specialize in Small molecules synthesis, supporting innovative research projects.
Reviews
Write Your Own Review