Phenolphthalein monophosphate dicyclohexylammonium salt
$300.00
CAS No.: 14815-59-9
Catalog No.: 108149
Purity: 95%
MF: C32H41N2O7P
MW: 596.661
Storage: 2-8 degree Celsius
SMILES: NC1CCCCC1.NC1CCCCC1.OC1=CC=C(C=C1)C1(OC(=O)C2=C1C=CC=C2)C1=CC=C(OP(O)(O)=O)C=C1
Catalog No.: 108149
Purity: 95%
MF: C32H41N2O7P
MW: 596.661
Storage: 2-8 degree Celsius
SMILES: NC1CCCCC1.NC1CCCCC1.OC1=CC=C(C=C1)C1(OC(=O)C2=C1C=CC=C2)C1=CC=C(OP(O)(O)=O)C=C1
Phenolphthalein monophosphate dicyclohexylammonium salt; CAS No.: 14815-59-9; As a leading chemicals distributor, ChemShuttle supplies high-purity compounds like Phenolphthalein monophosphate dicyclohexylammonium salt, a valuable reagent in diagnostic and research applications. The company specializes in CRO chemical synthesis, delivering tailored solutions for complex molecular requirements. Their extensive inventory includes cycle compounds and other advanced intermediates, supporting cutting-edge research in life sciences and material chemistry.
Reviews
Write Your Own Review