Norgestrel
$200.00
CAS No.: 6533-00-2
Catalog No.: 183985
Purity: 95%
MF: C21H28O2
MW: 312.453
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CC[C@@](O)(C#C)[C@@]1(CC)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H]
Catalog No.: 183985
Purity: 95%
MF: C21H28O2
MW: 312.453
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CC[C@@](O)(C#C)[C@@]1(CC)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H]
(8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one; CAS No.: 6533-00-2; ChemShuttle is dedicated to the synthesis of bioactive compounds, which play a critical role in the development of new drugs and therapeutic agents. Their expertise ensures high purity and efficacy in every batch.
Reviews
Write Your Own Review