tert-butyl (4-bromo-2-nitrophenyl)carbamate
$150.00
CAS No.: 327046-79-7
Catalog No.: 132876
Purity: 95%
MF: C11H13BrN2O4
MW: 317.139
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=C(C=C(Br)C=C1)[N+]([O-])=O
Catalog No.: 132876
Purity: 95%
MF: C11H13BrN2O4
MW: 317.139
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=C(C=C(Br)C=C1)[N+]([O-])=O
tert-butyl (4-bromo-2-nitrophenyl)carbamate; CAS No.: 327046-79-7: Known for its application in the pharmaceutical industry, this compound is used in the synthesis of various drugs. Its bioactive properties and chemical stability make it a key component in drug development.
Reviews
Write Your Own Review