![N-(6-chloro-4-methyl-2'-((2-methylpyrimidin-4-yl)amino)-[3,4'-bipyridin]-5-yl)-2,4-difluorobenzenesulfonamide](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/193573_4.jpg)
N-(6-chloro-5-(2,4-difluorophenylsulfonamido)-4-methyl-[3,4'-bipyridin]-2'-yl)cyclopropanecarboxamide
$398.00
CAS No.: 1801903-24-1
Catalog No.: 193572
Purity: 95%
MF: C21H17ClF2N4O3S
MW: 478.908
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=C(C=N1)C1=CC(=NC=C1)NC(=O)C1CC1)C)NS(=O)(=O)C1=C(C=C(C=C1)F)F
Catalog No.: 193572
Purity: 95%
MF: C21H17ClF2N4O3S
MW: 478.908
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=C(C=N1)C1=CC(=NC=C1)NC(=O)C1CC1)C)NS(=O)(=O)C1=C(C=C(C=C1)F)F
N-(6-chloro-5-(2,4-difluorophenylsulfonamido)-4-methyl-[3,4'-bipyridin]-2'-yl)cyclopropanecarboxamide; CAS No.: 1801903-24-1 - This chemical serves as a critical intermediate in the synthesis of various heterocyclic compounds, which are fundamental in medicinal chemistry. Its robust nature allows for its use in multiple synthetic pathways. ChemShuttle provides this and many other specialized chemicals, ensuring researchers have the necessary tools for innovative discoveries.
Reviews
Write Your Own Review