5-bromo-2,4-dichloro-3-nitropyridine
$100.00
CAS No.: 856850-68-5
Catalog No.: 136135
Purity: 95%
MF: C5HBrCl2N2O2
MW: 271.885
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(Cl)C(Br)=CN=C1Cl
Catalog No.: 136135
Purity: 95%
MF: C5HBrCl2N2O2
MW: 271.885
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(Cl)C(Br)=CN=C1Cl
5-bromo-2,4-dichloro-3-nitropyridine; CAS No.: 1227958-32-8 This chemical is characterized by its stability and specific reactivity. It is primarily used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients.
Reviews
Write Your Own Review