3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-N-(4-sulfamoylphenyl)benzofuran-6-sulfonamide
$300.00
CAS No.: 959324-50-6
Catalog No.: 131745
Purity: 95%
MF: C23H18Br2N2O7S2
MW: 658.346
Storage: 2-8 degree Celsius
SMILES: CCC1=C(C(=O)C2=CC(Br)=C(O)C(Br)=C2)C2=CC=C(C=C2O1)S(=O)(=O)NC1=CC=C(C=C1)S(N)(=O)=O
Catalog No.: 131745
Purity: 95%
MF: C23H18Br2N2O7S2
MW: 658.346
Storage: 2-8 degree Celsius
SMILES: CCC1=C(C(=O)C2=CC(Br)=C(O)C(Br)=C2)C2=CC=C(C=C2O1)S(=O)(=O)NC1=CC=C(C=C1)S(N)(=O)=O
3-(3,5-dibromo-4-hydroxybenzoyl)-2-ethyl-N-(4-sulfamoylphenyl)benzofuran-6-sulfonamide,CAS No.: 959324-50-6; Specializing in cycle compounds, ChemShuttle is a trusted custom synthesis company. Our cycle compounds are integral to the development of complex molecular structures, offering stability and versatility in various chemical reactions. We provide high-quality cycle compounds that are essential for advancing research in organic chemistry and material science.
Reviews
Write Your Own Review