1-(5-chloro-2-nitrophenyl)piperidine
$250.00
CAS No.: 53013-43-7
Catalog No.: 184821
Purity: 95%
MF: C11H13ClN2O2
MW: 240.69
Storage: 2-8 degree Celsius
SMILES: ClC=1C=CC(=C(C1)N1CCCCC1)[N+](=O)[O-]
Catalog No.: 184821
Purity: 95%
MF: C11H13ClN2O2
MW: 240.69
Storage: 2-8 degree Celsius
SMILES: ClC=1C=CC(=C(C1)N1CCCCC1)[N+](=O)[O-]
1-(5-chloro-2-nitrophenyl)piperidine; CAS No.: 68684-63-9 This chemical is known for its stability and reactivity. It is primarily used in the pharmaceutical industry for the synthesis of complex drug molecules.
Reviews
Write Your Own Review