![5-bromo-6-methyl-1H-benzo[d]imidazol-2(3H)-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/0/104515_3.jpg)
N1,N1-dimethyl-4-nitrobenzene-1,3-diamine
$150.00
CAS No.: 20691-71-8
Catalog No.: 104677
Purity: 95%
MF: C8H11N3O2
MW: 181.195
Storage: 2-8 degree Celsius
SMILES: CN(C)C1=CC=C(C(N)=C1)[N+]([O-])=O
Catalog No.: 104677
Purity: 95%
MF: C8H11N3O2
MW: 181.195
Storage: 2-8 degree Celsius
SMILES: CN(C)C1=CC=C(C(N)=C1)[N+]([O-])=O
N1,N1-dimethyl-4-nitrobenzene-1,3-diamine; CAS No.: 20691-71-8: Utilized in the production of heterocyclic compounds, this product is essential for the development of pharmaceuticals and agrochemicals. Its advantages include high reactivity and compatibility with various synthetic routes, ensuring efficient production processes.
Reviews
Write Your Own Review