N-(3-((4-amino-6,7-dimethoxyquinazolin-2-yl)(methyl)amino)propyl)furan-2-carboxamide hydrochloride
$450.00
CAS No.: 98902-29-5
Catalog No.: 101597
Purity: 95%
MF: C19H24ClN5O4
MW: 421.885
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC2=NC(=NC(N)=C2C=C1OC)N(C)CCCNC(=O)C1=CC=CO1
Catalog No.: 101597
Purity: 95%
MF: C19H24ClN5O4
MW: 421.885
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC2=NC(=NC(N)=C2C=C1OC)N(C)CCCNC(=O)C1=CC=CO1
N-(3-((4-amino-6,7-dimethoxyquinazolin-2-yl)(methyl)amino)propyl)furan-2-carboxamide hydrochloride; CAS No.: 98902-29-5; N-(3-((4-amino-6,7-dimethoxyquinazolin-2-yl)(methyl)amino)propyl)furan-2-carboxamide hydrochloride represents ChemShuttle's chem blocks. This complex amide derivative serves as a valuable intermediate in pharmaceutical research. As a custom chemical synthesis company, ChemShuttle offers this compound with high purity for reliable reaction outcomes. The various functional groups provide numerous points for modification and further synthesis. Researchers benefit from ChemShuttle's expertise in handling such nitrogen-rich compounds during synthesis processes.
Reviews
Write Your Own Review