methyl (S)-3-amino-3-phenylpropanoate hydrochloride
$300.00
CAS No.: 144494-72-4
Catalog No.: 188918
Purity: 95%
MF: C10H14ClNO2
MW: 215.68
Storage: 2-8 degree Celsius
SMILES: Cl.N[C@@H](CC(=O)OC)C1=CC=CC=C1
Catalog No.: 188918
Purity: 95%
MF: C10H14ClNO2
MW: 215.68
Storage: 2-8 degree Celsius
SMILES: Cl.N[C@@H](CC(=O)OC)C1=CC=CC=C1
methyl (S)-3-amino-3-phenylpropanoate hydrochloride; CAS No.: 144494-72-4; methyl (S)-3-amino-3-phenylpropanoate hydrochloride exemplifies the pharma building blocks category within Chem Shuttle's product offerings. As a chemical online mall, Chem Shuttle provides access to chiral compounds that are crucial for drug development. This particular amino acid derivative, with its phenyl substituent and amino group, is a key intermediate in the synthesis of various pharmaceuticals, particularly those requiring stereo-specific configurations. Chem Shuttle's custom compound synthesis services allow for the production of such enantiomerically pure compounds to precise specifications. The company's focus on blocks chemistry ensures that researchers can obtain high-purity materials like methyl (S)-3-amino-3-phenylpropanoate hydrochloride, facilitating the advancement of chiral drug discovery and development.
Reviews
Write Your Own Review