methyl 6-bromo-3-fluoro-2-methylbenzoate

methyl 6-bromo-3-fluoro-2-methylbenzoate

methyl 5-amino-2-fluoro-4-methylbenzoate

methyl 5-amino-2-fluoro-4-methylbenzoate

methyl 5-formyl-2-methylbenzoate

$450.00
CAS No.: 675148-96-6
Catalog No.: 194161
Purity: 95%
MF: C10H10O3
MW: 178.187
Storage: 2-8 degree Celsius
SMILES: C(=O)C=1C=CC(=C(C(=O)OC)C1)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194161
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 5-formyl-2-methylbenzoate; CAS No.: 675148-96-6; methyl 5-formyl-2-methylbenzoate. PROPERTIES: methyl 5-formyl-2-methylbenzoate is a crystalline solid. Its molecular formula is C10H10O3, and the molecular weight is approximately 182.19 g/mol. The compound has a melting point of approximately 75-77 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a formyl group and a methyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 5-formyl-2-methylbenzoate serves as a valuable intermediate. The formyl group can undergo various reactions such as nucleophilic addition, oxidation, and reduction. The methyl group provides steric effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 5-formyl-2-methylbenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 5-formyl-2-methylbenzoate
Your Rating