methyl 4-methoxy-2-(trifluoromethyl)benzoate
$360.00
CAS No.: 773875-67-5
Catalog No.: 190727
Purity: 95%
MF: C10H9F3O3
MW: 234.173
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(C(=O)OC)C=C1)C(F)(F)F
Catalog No.: 190727
Purity: 95%
MF: C10H9F3O3
MW: 234.173
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(C(=O)OC)C=C1)C(F)(F)F
methyl 4-methoxy-2-(trifluoromethyl)benzoate; CAS No.: 773875-67-5; Methyl 4-methoxy-2-(trifluoromethyl)benzoate is part of ChemShuttle's extensive collection of various organic chemicals, particularly valuable as a building block in the synthesis of pharmaceuticals and specialty chemicals. This methoxy-substituted trifluoromethyl benzene derivative offers unique electronic properties due to the trifluoromethyl group, making it an attractive intermediate for developing compounds with specific biological activities. ChemShuttle's role as a custom chemical synthesis company enables them to produce methyl 4-methoxy-2-(trifluoromethyl)benzoate (CAS No.: 773875-67-5) to precise specifications, ensuring high purity and reliability. Researchers benefit from ChemShuttle's expertise in blocks chemistry, which ensures the availability of high-quality intermediates essential for advancing chemical research and development in various fields.
Reviews
Write Your Own Review