methyl 4-(bromomethyl)-3-nitrobenzoate
$250.00
CAS No.: 88089-94-5
Catalog No.: 189343
Purity: 95%
MF: C9H8BrNO4
MW: 274.07
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C=C(C(=O)OC)C=C1)[N+](=O)[O-]
Catalog No.: 189343
Purity: 95%
MF: C9H8BrNO4
MW: 274.07
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C=C(C(=O)OC)C=C1)[N+](=O)[O-]
methyl 4-(bromomethyl)-3-nitrobenzoate; CAS No.: 88089-94-5; methyl 4-(bromomethyl)-3-nitrobenzoate exemplifies the bromomethylbenzoate category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to benzoate derivatives with bromomethyl and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its bromomethyl and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that methyl 4-(bromomethyl)-3-nitrobenzoate is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review