methyl 4-carboxyl-2-fluorobenzoate

methyl 4-carboxyl-2-fluorobenzoate

methyl 4,5-difluoro-2-methylbenzoate

methyl 4,5-difluoro-2-methylbenzoate

methyl 4-bromo-3-fluoro-2-methylbenzoate

$200.00
CAS No.: 1365969-22-7
Catalog No.: 194148
Purity: 95%
MF: C9H8BrFO2
MW: 247.063
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)OC)C=C1)C)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194148
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-bromo-3-fluoro-2-methylbenzoate; CAS No.: 1365969-22-7; methyl 4-bromo-3-fluoro-2-methylbenzoate. PROPERTIES: methyl 4-bromo-3-fluoro-2-methylbenzoate is a crystalline solid. Its molecular formula is C10H8BrFO2, and the molecular weight is approximately 253.08 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated and fluorinated aromatic compound containing a methyl group and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-bromo-3-fluoro-2-methylbenzoate serves as a versatile intermediate. The bromine atom provides a site for substitution or coupling reactions, the fluorine atom influences the electronic properties of the aromatic ring, and the methyl group offers steric effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 4-bromo-3-fluoro-2-methylbenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-bromo-3-fluoro-2-methylbenzoate
Your Rating