methyl 4-amino-3,5-dichlorobenzoate
$200.00
CAS No.: 41727-48-4
Catalog No.: 190616
Purity: 95%
MF: C8H7Cl2NO2
MW: 220.055
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(C(=O)OC)C=C1Cl)Cl
Catalog No.: 190616
Purity: 95%
MF: C8H7Cl2NO2
MW: 220.055
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(C(=O)OC)C=C1Cl)Cl
methyl 4-amino-3,5-dichlorobenzoate; CAS No.: 41727-48-4; methyl 4-amino-3,5-dichlorobenzoate. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including methyl 4-amino-3,5-dichlorobenzoate (CAS No.: 41727-48-4). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review