methyl 3-methoxy-4-nitrobenzoate
$200.00
CAS No.: 5081-37-8
Catalog No.: 189293
Purity: 95%
MF: C9H9NO5
MW: 211.173
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C(=O)OC)C=CC1[N+](=O)[O-]
Catalog No.: 189293
Purity: 95%
MF: C9H9NO5
MW: 211.173
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C(=O)OC)C=CC1[N+](=O)[O-]
methyl 3-methoxy-4-nitrobenzoate; CAS No.: 5081-37-8; methyl 3-methoxy-4-nitrobenzoate exemplifies the methoxynitrobenzoates category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to benzoate derivatives with methoxy and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its methoxy and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized methoxynitrobenzoates to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity methyl 3-methoxy-4-nitrobenzoate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review