methyl 3-cyano-5-nitrobenzoate
$200.00
CAS No.: 99066-80-5
Catalog No.: 127023
Purity: 95%
MF: C9H6N2O4
MW: 206.157
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(=CC(=C1)C#N)[N+]([O-])=O
Catalog No.: 127023
Purity: 95%
MF: C9H6N2O4
MW: 206.157
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=CC(=CC(=C1)C#N)[N+]([O-])=O
methyl 3-cyano-5-nitrobenzoate; CAS No.: 99066-80-5; methyl 3-cyano-5-nitrobenzoate is a multifunctional compound valuable in medicinal chemistry. It falls under ChemShuttle's chemical building blocks category, which is essential for the creation of complex molecular architectures. As a Leading Chemicals Distributor, ChemShuttle offers custom chemical synthesis services, making such specialized compounds available to researchers engaged in drug discovery initiatives.
Reviews
Write Your Own Review