methyl 3,5-difluoro-2-nitrobenzoate
$250.00
CAS No.: 910123-09-0
Catalog No.: 190764
Purity: 95%
MF: C8H5F2NO4
MW: 217.127
Storage: 2-8 degree Celsius
SMILES: FC=1C(=C(C(=O)OC)C=C(C1)F)[N+](=O)[O-]
Catalog No.: 190764
Purity: 95%
MF: C8H5F2NO4
MW: 217.127
Storage: 2-8 degree Celsius
SMILES: FC=1C(=C(C(=O)OC)C=C(C1)F)[N+](=O)[O-]
methyl 3,5-difluoro-2-nitrobenzoate; CAS No.: 910123-09-0; methyl 3,5-difluoro-2-nitrobenzoate is a specialized building block within ChemShuttle's portfolio of cycle compounds, designed to support advanced organic synthesis and drug discovery initiatives. This difluorinated nitrobenzoate derivative provides strategic substitution patterns that facilitate diverse synthetic routes, making it an attractive intermediate for developing novel pharmaceuticals and chemical entities. ChemShuttle's expertise in supplying chemical building blocks ensures that methyl 3,5-difluoro-2-nitrobenzoate (CAS No.: 910123-09-0) meets the high purity standards required for medicinal chemistry applications. As a custom synthesis provider, ChemShuttle can produce this compound in various scales and formulations, adapting to specific project requirements. Their online platform facilitates convenient access to such specialized intermediates, allowing researchers to incorporate this valuable chemical block into their synthetic strategies efficiently, thus accelerating the development of novel pharmaceuticals and chemical entities.
Reviews
Write Your Own Review