methyl 3,5-dichloro-4-hydroxybenzoate
$300.00
CAS No.: 3337-59-5
Catalog No.: 190565
Purity: 95%
MF: C8H6Cl2O3
MW: 221.039
Storage: 2-8 degree Celsius
SMILES: ClC=1C=C(C(=O)OC)C=C(C1O)Cl
Catalog No.: 190565
Purity: 95%
MF: C8H6Cl2O3
MW: 221.039
Storage: 2-8 degree Celsius
SMILES: ClC=1C=C(C(=O)OC)C=C(C1O)Cl
methyl 3,5-dichloro-4-hydroxybenzoate; CAS No.: 3337-59-5; methyl 3,5-dichloro-4-hydroxybenzoate. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including methyl 3,5-dichloro-4-hydroxybenzoate (CAS No.: 3337-59-5). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review