1-(3,5-difluoro-2-hydroxyphenyl)ethan-1-one

1-(3,5-difluoro-2-hydroxyphenyl)ethan-1-one

2-((3-chloro-4-fluorophenyl)amino)-2-(5-fluoro-2-hydroxyphenyl)acetonitrile

2-((3-chloro-4-fluorophenyl)amino)-2-(5-fluoro-2-hydroxyphenyl)acetonitrile

methyl 3,4-dihydroxy-2,5-dimethylbenzoate

$390.00
CAS No.: 956477-64-8
Catalog No.: 194474
Purity: 95%
MF: C10H12O4
MW: 196.202
Storage: 2-8 degree Celsius
SMILES: OC=1C(=C(C(=O)OC)C=C(C1O)C)C
Availability:
In stock
SKU
194474
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 3,4-dihydroxy-2,5-dimethylbenzoate; CAS No.: 956477-64-8; methyl 3,4-dihydroxy-2,5-dimethylbenzoate. PROPERTIES: methyl 3,4-dihydroxy-2,5-dimethylbenzoate is a crystalline solid. Its molecular formula is C10H10O5, and the molecular weight is approximately 202.19 g/mol. The compound has a melting point of approximately 130-132 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and ethyl acetate. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, two hydroxyl groups, a methyl group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 3,4-dihydroxy-2,5-dimethylbenzoate serves as a valuable intermediate. The hydroxyl groups can undergo reactions such as etherification and esterification. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl 3,4-dihydroxy-2,5-dimethylbenzoate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 3,4-dihydroxy-2,5-dimethylbenzoate
Your Rating