methyl 3-(4-(chlorosulfonyl)phenyl)propanoate
$300.00
CAS No.: 374537-95-8
Catalog No.: 190584
Purity: 95%
MF: C10H11ClO4S
MW: 262.714
Storage: 2-8 degree Celsius
SMILES: ClS(=O)(=O)C1=CC=C(C=C1)CCC(=O)OC
Catalog No.: 190584
Purity: 95%
MF: C10H11ClO4S
MW: 262.714
Storage: 2-8 degree Celsius
SMILES: ClS(=O)(=O)C1=CC=C(C=C1)CCC(=O)OC
methyl 3-(4-(chlorosulfonyl)phenyl)propanoate; CAS No.: 374537-95-8; methyl 3-(4-(chlorosulfonyl)phenyl)propanoate. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including methyl 3-(4-(chlorosulfonyl)phenyl)propanoate (CAS No.: 374537-95-8). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review