methyl 2-iodo-3-nitrobenzoate
$300.00
CAS No.: 93415-79-3
Catalog No.: 190769
Purity: 95%
MF: C8H6INO4
MW: 307.043
Storage: 2-8 degree Celsius
SMILES: IC1=C(C(=O)OC)C=CC=C1[N+](=O)[O-]
Catalog No.: 190769
Purity: 95%
MF: C8H6INO4
MW: 307.043
Storage: 2-8 degree Celsius
SMILES: IC1=C(C(=O)OC)C=CC=C1[N+](=O)[O-]
methyl 2-iodo-3-nitrobenzoate; CAS No.: 93415-79-3; methyl 2-iodo-3-nitrobenzoate is part of ChemShuttle's extensive inventory of heterocycles and various organic chemicals, serving as a valuable building block in organic synthesis and drug discovery. This iodinated nitrobenzoate derivative provides strategic positions for further functionalization, making it an attractive intermediate for developing novel pharmaceuticals and chemical entities. ChemShuttle's commitment to supplying key intermediates ensures that methyl 2-iodo-3-nitrobenzoate (CAS No.: 93415-79-3) meets the high quality standards required for medicinal chemistry applications. As a custom chemical synthesis company, ChemShuttle offers flexible production options for this compound, allowing researchers to obtain it in the specific form and quantity needed for their projects. Their role as a leading chemicals distributor is reinforced by their ability to provide such specialized intermediates efficiently, supporting advancements in chemical research and development.
Reviews
Write Your Own Review