methyl 2-cyano-5-methylbenzoate

methyl 2-cyano-5-methylbenzoate

methyl 2-chloro-5-fluoro-3-methylbenzoate

methyl 2-chloro-5-fluoro-3-methylbenzoate

methyl 2-chloro-6-methoxybenzoate

$300.00
CAS No.: 936479-46-8
Catalog No.: 194124
Purity: 95%
MF: C9H9ClO3
MW: 200.621
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OC)C(=CC=C1)OC
Availability:
In stock
SKU
194124
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-chloro-6-methoxybenzoate; CAS No.: 936479-46-8; methyl 2-chloro-6-methoxybenzoate. PROPERTIES: methyl 2-chloro-6-methoxybenzoate is a crystalline solid. Its molecular formula is C10H9ClO3, and the molecular weight is approximately 212.63 g/mol. The compound has a melting point of approximately 55-57 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a chlorinated aromatic compound containing a methoxy and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2-chloro-6-methoxybenzoate serves as a versatile intermediate. The chlorine atom provides a site for substitution reactions, the methoxy group can be converted to other functional groups such as hydroxyl or halide, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl 2-chloro-6-methoxybenzoate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-chloro-6-methoxybenzoate
Your Rating