methyl 2-chloro-2-(2-chlorophenyl)acetate
$300.00
CAS No.: 90055-47-3
Catalog No.: 196549
Purity: 95%
MF: C9H8Cl2O2
MW: 219.067
Storage: 2-8 degree Celsius
SMILES: ClC(C(=O)OC)C1=C(C=CC=C1)Cl
Catalog No.: 196549
Purity: 95%
MF: C9H8Cl2O2
MW: 219.067
Storage: 2-8 degree Celsius
SMILES: ClC(C(=O)OC)C1=C(C=CC=C1)Cl
methyl 2-chloro-2-(2-chlorophenyl)acetate; CAS No.: 90055-47-3; methyl 2-chloro-2-(2-chlorophenyl)acetate. PROPERTIES: Methyl 2-chloro-2-(2-chlorophenyl)acetate is a colorless liquid with molecular formula C10H8Cl2O2. It has a characteristic chlorinated aroma and low water solubility. This compound should be stored below 5 C in tightly sealed containers, preferably under nitrogen atmosphere to prevent hydrolysis. Safety considerations include using explosion-proof ventilation systems and avoiding static discharges. In case of vapor inhalation, remove to fresh air and administer oxygen if needed. APPLICATIONS: This compound functions as a key intermediate in the production of certain antipsychotic medications where its dichlorophenyl group contributes to receptor binding affinity (pharmaceutical industry). In specialty chemical synthesis, methyl 2-chloro-2-(2-chlorophenyl)acetate serves as a chiral precursor for optically active compounds through resolution or asymmetric synthesis (specialty chemicals manufacturing). Its dichlorinated structure enables selective derivatization for the development of fluorescent probes used in bioimaging applications (bioanalytical chemistry research).
Reviews
Write Your Own Review