methyl 2-(bromomethyl)-6-nitrobenzoate
$320.00
CAS No.: 61940-21-4
Catalog No.: 126898
Purity: 95%
MF: C9H8BrNO4
MW: 274.07
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C=CC=C1CBr)[N+]([O-])=O
Catalog No.: 126898
Purity: 95%
MF: C9H8BrNO4
MW: 274.07
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C=CC=C1CBr)[N+]([O-])=O
methyl 2-(bromomethyl)-6-nitrobenzoate; CAS No.: 61940-21-4; methyl 2-(bromomethyl)-6-nitrobenzoate is a multifunctional compound valuable in medicinal chemistry. This compound represents part of ChemShuttle's various organic chemicals category, which is essential for the development of new pharmaceutical agents. As a chemical synthesis company, ChemShuttle provides custom compound synthesis services, enabling researchers to obtain this and similar compounds tailored to their specific research requirements.
Reviews
Write Your Own Review