methyl 2-bromo-2-(4-fluorophenyl)acetate

methyl 2-bromo-2-(4-fluorophenyl)acetate

methyl 2,4-dichloro-6-fluorobenzoate

methyl 2,4-dichloro-6-fluorobenzoate

methyl 2-amino-4-bromo-6-fluorobenzoate

$180.00
CAS No.: 1698028-23-7
Catalog No.: 194116
Purity: 95%
MF: C8H7BrFNO2
MW: 248.051
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=O)OC)C(=CC(=C1)Br)F
Availability:
In stock
SKU
194116
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-amino-4-bromo-6-fluorobenzoate; CAS No.: 1698028-23-7; methyl 2-amino-4-bromo-6-fluorobenzoate. PROPERTIES: methyl 2-amino-4-bromo-6-fluorobenzoate is a crystalline solid. Its molecular formula is C9H7BrFNO3, and the molecular weight is approximately 269.06 g/mol. The compound has a melting point of approximately 120-122 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group, a bromine atom, and a fluorine atom, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 2-amino-4-bromo-6-fluorobenzoate serves as a valuable intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The bromine and fluorine atoms provide sites for further substitution or coupling reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antiviral drugs, the unique substituents of methyl 2-amino-4-bromo-6-fluorobenzoate can be utilized to design drugs with enhanced antiviral activity and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-amino-4-bromo-6-fluorobenzoate
Your Rating