methyl 2-(4-nitrophenyl)acetate
$375.00
CAS No.: 2945-08-6
Catalog No.: 189313
Purity: 95%
MF: C9H9NO4
MW: 195.174
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(C=C1)CC(=O)OC
Catalog No.: 189313
Purity: 95%
MF: C9H9NO4
MW: 195.174
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC=C(C=C1)CC(=O)OC
methyl 2-(4-nitrophenyl)acetate; CAS No.: 2945-08-6; methyl 2-(4-nitrophenyl)acetate exemplifies the nitrophenyl acetate category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to acetate derivatives with nitrophenyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its nitrophenyl group, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that methyl 2-(4-nitrophenyl)acetate is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review