methyl 2-(3-bromo-5-methoxyphenyl)acetate
$368.00
CAS No.: 1261476-25-8
Catalog No.: 198374
Purity: 95%
MF: C10H11BrO3
MW: 259.099
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=C(C1)OC)CC(=O)OC
Catalog No.: 198374
Purity: 95%
MF: C10H11BrO3
MW: 259.099
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=C(C1)OC)CC(=O)OC
CAS No.:1261476-25-8;methyl 2-(3-bromo-5-methoxyphenyl)acetate;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the methyl 2-(3-bromo-5-methoxyphenyl)acetate (CAS No.:1261476-25-8). This compound combines the reactivity of a bromo group with the stability imparted by the methoxy substituent and acetate core, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The bromo functionality provides a valuable point for chemical modification, while the methoxy substituent and acetate group offer unique electronic properties. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review