methyl 2-(3-(aminomethyl)phenyl)acetate hydrochloride
$1,000.00
CAS No.: 197792-60-2
Catalog No.: 104596
Purity: 95%
MF: C10H14ClNO2
MW: 215.68
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC(=O)CC1=CC=CC(CN)=C1
Catalog No.: 104596
Purity: 95%
MF: C10H14ClNO2
MW: 215.68
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC(=O)CC1=CC=CC(CN)=C1
For R&D use only. Not for human or animal use.
methyl 2-(3-(aminomethyl)phenyl)acetate hydrochloride; CAS No.: 197792-60-2 This chemical compound is characterized by its specific molecular structure, which determines its physical and chemical properties such as solubility, melting point, and reactivity. It is primarily used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients (APIs) or as an intermediate in organic synthesis. Its precise applications depend on its functional groups and reactivity.
Reviews
Write Your Own Review