methyl 2,4-bis(trifluoromethyl)benzoate

methyl 2,4-bis(trifluoromethyl)benzoate

methyl 2-(4-bromo-3-fluorophenyl)acetate

methyl 2-(4-bromo-3-fluorophenyl)acetate

methyl 2,3,5-trichloro-4-methylbenzoate

$300.00
CAS No.: 89978-34-7
Catalog No.: 194113
Purity: 95%
MF: C9H7Cl3O2
MW: 253.512
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OC)C=C(C(=C1Cl)C)Cl
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194113
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2,3,5-trichloro-4-methylbenzoate; CAS No.: 89978-34-7; methyl 2,3,5-trichloro-4-methylbenzoate. PROPERTIES: methyl 2,3,5-trichloro-4-methylbenzoate is a crystalline solid. Its molecular formula is C9H6Cl3O2, and the molecular weight is approximately 255.53 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a highly chlorinated aromatic compound, it may exhibit certain stability and reactivity. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 2,3,5-trichloro-4-methylbenzoate serves as a specialized intermediate. The three chloro groups provide multiple sites for substitution reactions, and the methyl group offers steric effects. In the chemical industry, it can be used as a raw material for the synthesis of various organic compounds. For example, in the preparation of certain agrochemicals, the structure of methyl 2,3,5-trichloro-4-methylbenzoate can be utilized to design compounds with improved herbicidal or pesticidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2,3,5-trichloro-4-methylbenzoate
Your Rating